C8H10N4O3 — CID 114404952
5-amino-6-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid (PubChem CID 114404952) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 5-amino-6-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 5-amino-6-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114404952 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-amino-6-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid |
| SMILES | NC(=O)CNc1nc(C(=O)O)ccc1N |
| InChI | InChI=1S/C8H10N4O3/c9-4-1-2-5(8(14)15)12-7(4)11-3-6(10)13/h1-2H,3,9H2,(H2,10,13)(H,11,12)(H,14,15) |
| InChIKey | BASXBMCHTCHVKX-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |