C26H31Cl2N5O4S — CID 22452889
tert-butyl N-[2-[[2-[2-(4-chloroanilino)ethylamino]-3-pyridinyl]-(4-chlorophenyl)sulfonylamino]ethyl]carbamate (PubChem CID 22452889) has the molecular formula C26H31Cl2N5O4S and a molecular weight of 580.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[2-(4-chloroanilino)ethylamino]-3-pyridinyl]-(4-chlorophenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[2-(4-chloroanilino)ethylamino]-3-pyridinyl]-(4-chlorophenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 22452889 |
| Molecular Formula | C26H31Cl2N5O4S |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | tert-butyl N-[2-[[2-[2-(4-chloroanilino)ethylamino]-3-pyridinyl]-(4-chlorophenyl)sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(c1cccnc1NCCNc1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H31Cl2N5O4S/c1-26(2,3)37-25(34)32-17-18-33(38(35,36)22-12-8-20(28)9-13-22)23-5-4-14-30-24(23)31-16-15-29-21-10-6-19(27)7-11-21/h4-14,29H,15-18H2,1-3H3,(H,30,31)(H,32,34) |
| InChIKey | KKHNRFSNVULWFV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|