C30H29Cl3N4O6S2 — CID 139812396
[1-(4-chlorophenyl)-2-methylpropan-2-yl] N-[1-[[3-[bis[(4-chlorophenyl)sulfonyl]amino]-2-pyridinyl]amino]ethyl]carbamate (PubChem CID 139812396) has the molecular formula C30H29Cl3N4O6S2 and a molecular weight of 712.08 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-methylpropan-2-yl] N-[1-[[3-[bis[(4-chlorophenyl)sulfonyl]amino]-2-pyridinyl]amino]ethyl]carbamate.
| Compound Name | [1-(4-chlorophenyl)-2-methylpropan-2-yl] N-[1-[[3-[bis[(4-chlorophenyl)sulfonyl]amino]-2-pyridinyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 139812396 |
| Molecular Formula | C30H29Cl3N4O6S2 |
| Molecular Weight | 712.08 g/mol |
| Exact Mass | 710.06 |
| IUPAC Name | [1-(4-chlorophenyl)-2-methylpropan-2-yl] N-[1-[[3-[bis[(4-chlorophenyl)sulfonyl]amino]-2-pyridinyl]amino]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)Cc1ccc(Cl)cc1)Nc1ncccc1N(S(=O)(=O)c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29Cl3N4O6S2/c1-20(36-29(38)43-30(2,3)19-21-6-8-22(31)9-7-21)35-28-27(5-4-18-34-28)37(44(39,40)25-14-10-23(32)11-15-25)45(41,42)26-16-12-24(33)13-17-26/h4-18,20H,19H2,1-3H3,(H,34,35)(H,36,38) |
| InChIKey | IADYXXRSEHTGSQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.08 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|