C19H23ClN2O3 — CID 164562669
[1-[2-[1-(4-chlorophenyl)-1-hydroxypropyl]-3-pyridinyl]-2-methylpropan-2-yl] carbamate (PubChem CID 164562669) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is [1-[2-[1-(4-chlorophenyl)-1-hydroxypropyl]-3-pyridinyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[2-[1-(4-chlorophenyl)-1-hydroxypropyl]-3-pyridinyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 164562669 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [1-[2-[1-(4-chlorophenyl)-1-hydroxypropyl]-3-pyridinyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CCC(O)(c1ccc(Cl)cc1)c1ncccc1CC(C)(C)OC(N)=O |
| InChI | InChI=1S/C19H23ClN2O3/c1-4-19(24,14-7-9-15(20)10-8-14)16-13(6-5-11-22-16)12-18(2,3)25-17(21)23/h5-11,24H,4,12H2,1-3H3,(H2,21,23) |
| InChIKey | TURJMJWXQYIIIR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |