C11H14ClNO2 — CID 100919587
(3R)-3-(4-chlorophenyl)-3-hydroxypentanamide (PubChem CID 100919587) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-3-hydroxypentanamide.
| Compound Name | (3R)-3-(4-chlorophenyl)-3-hydroxypentanamide |
|---|---|
| PubChem CID | 100919587 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-3-hydroxypentanamide |
| SMILES | CC[C@@](O)(CC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO2/c1-2-11(15,7-10(13)14)8-3-5-9(12)6-4-8/h3-6,15H,2,7H2,1H3,(H2,13,14)/t11-/m1/s1 |
| InChIKey | FNDAFMSHNJTRIM-LLVKDONJSA-N |
| XLogP | 1.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |