C10H12ClIN2O2 — CID 151731421
[1-(2-chloro-3-iodo-4-pyridinyl)-2-methylpropan-2-yl] carbamate (PubChem CID 151731421) has the molecular formula C10H12ClIN2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is [1-(2-chloro-3-iodo-4-pyridinyl)-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-(2-chloro-3-iodo-4-pyridinyl)-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 151731421 |
| Molecular Formula | C10H12ClIN2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | [1-(2-chloro-3-iodo-4-pyridinyl)-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)(Cc1ccnc(Cl)c1I)OC(N)=O |
| InChI | InChI=1S/C10H12ClIN2O2/c1-10(2,16-9(13)15)5-6-3-4-14-8(11)7(6)12/h3-4H,5H2,1-2H3,(H2,13,15) |
| InChIKey | RKQFFKBAJIZGFE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|