C11H16BrN3O2 — CID 174478259
[1-[5-(2-bromoethyl)pyrazin-2-yl]-2-methylpropan-2-yl] carbamate (PubChem CID 174478259) has the molecular formula C11H16BrN3O2 and a molecular weight of 302.17 g/mol. Its IUPAC name is [1-[5-(2-bromoethyl)pyrazin-2-yl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[5-(2-bromoethyl)pyrazin-2-yl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 174478259 |
| Molecular Formula | C11H16BrN3O2 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [1-[5-(2-bromoethyl)pyrazin-2-yl]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)(Cc1cnc(CCBr)cn1)OC(N)=O |
| InChI | InChI=1S/C11H16BrN3O2/c1-11(2,17-10(13)16)5-9-7-14-8(3-4-12)6-15-9/h6-7H,3-5H2,1-2H3,(H2,13,16) |
| InChIKey | GLRTYQVVKBTYNM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|