C13H17BrN2O3 — CID 151464602
[1-[4-[(2-bromoacetyl)amino]phenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 151464602) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is [1-[4-[(2-bromoacetyl)amino]phenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[4-[(2-bromoacetyl)amino]phenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 151464602 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | [1-[4-[(2-bromoacetyl)amino]phenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)(Cc1ccc(NC(=O)CBr)cc1)OC(N)=O |
| InChI | InChI=1S/C13H17BrN2O3/c1-13(2,19-12(15)18)7-9-3-5-10(6-4-9)16-11(17)8-14/h3-6H,7-8H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | PJEKSTTZCYHAFG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|