C19H23N3O5S — CID 174376730
[1-[4-[[3-(methanesulfonamido)benzoyl]amino]phenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 174376730) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is [1-[4-[[3-(methanesulfonamido)benzoyl]amino]phenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[4-[[3-(methanesulfonamido)benzoyl]amino]phenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 174376730 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [1-[4-[[3-(methanesulfonamido)benzoyl]amino]phenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)(Cc1ccc(NC(=O)c2cccc(NS(C)(=O)=O)c2)cc1)OC(N)=O |
| InChI | InChI=1S/C19H23N3O5S/c1-19(2,27-18(20)24)12-13-7-9-15(10-8-13)21-17(23)14-5-4-6-16(11-14)22-28(3,25)26/h4-11,22H,12H2,1-3H3,(H2,20,24)(H,21,23) |
| InChIKey | FNHPFTFCYQOSID-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |