C19H21ClF2N2O3S2 — CID 100654278
N-[2-(4-chlorophenyl)sulfanylethyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide (PubChem CID 100654278) has the molecular formula C19H21ClF2N2O3S2 and a molecular weight of 462.97 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100654278 |
| Molecular Formula | C19H21ClF2N2O3S2 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)NCCSc1ccc(Cl)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H21ClF2N2O3S2/c1-29(26,27)24(15-6-9-17(21)18(22)13-15)11-2-3-19(25)23-10-12-28-16-7-4-14(20)5-8-16/h4-9,13H,2-3,10-12H2,1H3,(H,23,25) |
| InChIKey | OGTDGWQTBJRUNR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|