C17H27ClN2O3S2 — CID 53285469
N-(2-tert-butylsulfanylethyl)-4-(3-chloro-N-methylsulfonylanilino)butanamide (PubChem CID 53285469) has the molecular formula C17H27ClN2O3S2 and a molecular weight of 407.00 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-4-(3-chloro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-4-(3-chloro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 53285469 |
| Molecular Formula | C17H27ClN2O3S2 |
| Molecular Weight | 407.00 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-4-(3-chloro-N-methylsulfonylanilino)butanamide |
| SMILES | CC(C)(C)SCCNC(=O)CCCN(c1cccc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H27ClN2O3S2/c1-17(2,3)24-12-10-19-16(21)9-6-11-20(25(4,22)23)15-8-5-7-14(18)13-15/h5,7-8,13H,6,9-12H2,1-4H3,(H,19,21) |
| InChIKey | INJUCKMPBGYDRH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.00 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|