C19H30F2N2O3S — CID 133202028
4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide (PubChem CID 133202028) has the molecular formula C19H30F2N2O3S and a molecular weight of 404.52 g/mol. Its IUPAC name is 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide.
| Compound Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide |
|---|---|
| PubChem CID | 133202028 |
| Molecular Formula | C19H30F2N2O3S |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide |
| SMILES | CCCCC(CC)CNC(=O)CCCN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H30F2N2O3S/c1-4-6-8-15(5-2)14-22-19(24)9-7-12-23(27(3,25)26)16-10-11-17(20)18(21)13-16/h10-11,13,15H,4-9,12,14H2,1-3H3,(H,22,24) |
| InChIKey | SLBQYIQHDBKQEF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |