C20H33ClN2O3S — CID 133200434
4-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide (PubChem CID 133200434) has the molecular formula C20H33ClN2O3S and a molecular weight of 417.02 g/mol. Its IUPAC name is 4-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide.
| Compound Name | 4-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide |
|---|---|
| PubChem CID | 133200434 |
| Molecular Formula | C20H33ClN2O3S |
| Molecular Weight | 417.02 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 4-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)butanamide |
| SMILES | CCCCC(CC)CNC(=O)CCCN(c1ccc(C)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H33ClN2O3S/c1-5-7-9-17(6-2)15-22-20(24)10-8-13-23(27(4,25)26)18-12-11-16(3)19(21)14-18/h11-12,14,17H,5-10,13,15H2,1-4H3,(H,22,24) |
| InChIKey | JNLKAIYNLPMSMI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.02 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |