C20H24Cl2N2O3S — CID 100500066
4-(3,4-dichloro-N-methylsulfonylanilino)-N-[(2R)-2-phenylpropyl]butanamide (PubChem CID 100500066) has the molecular formula C20H24Cl2N2O3S and a molecular weight of 443.40 g/mol. Its IUPAC name is 4-(3,4-dichloro-N-methylsulfonylanilino)-N-[(2R)-2-phenylpropyl]butanamide.
| Compound Name | 4-(3,4-dichloro-N-methylsulfonylanilino)-N-[(2R)-2-phenylpropyl]butanamide |
|---|---|
| PubChem CID | 100500066 |
| Molecular Formula | C20H24Cl2N2O3S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 4-(3,4-dichloro-N-methylsulfonylanilino)-N-[(2R)-2-phenylpropyl]butanamide |
| SMILES | C[C@@H](CNC(=O)CCCN(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C20H24Cl2N2O3S/c1-15(16-7-4-3-5-8-16)14-23-20(25)9-6-12-24(28(2,26)27)17-10-11-18(21)19(22)13-17/h3-5,7-8,10-11,13,15H,6,9,12,14H2,1-2H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | XRPVMJGTJHOCIE-HNNXBMFYSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |