C24H34N2O3S — CID 133200487
4-(2,6-diethyl-N-methylsulfonylanilino)-N-(2-phenylpropyl)butanamide (PubChem CID 133200487) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is 4-(2,6-diethyl-N-methylsulfonylanilino)-N-(2-phenylpropyl)butanamide.
| Compound Name | 4-(2,6-diethyl-N-methylsulfonylanilino)-N-(2-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 133200487 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 4-(2,6-diethyl-N-methylsulfonylanilino)-N-(2-phenylpropyl)butanamide |
| SMILES | CCc1cccc(CC)c1N(CCCC(=O)NCC(C)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H34N2O3S/c1-5-20-14-10-15-21(6-2)24(20)26(30(4,28)29)17-11-16-23(27)25-18-19(3)22-12-8-7-9-13-22/h7-10,12-15,19H,5-6,11,16-18H2,1-4H3,(H,25,27) |
| InChIKey | WWMQRSNXWVRBEO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |