C22H38N2O3S — CID 133200489
N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-propan-2-ylanilino)butanamide (PubChem CID 133200489) has the molecular formula C22H38N2O3S and a molecular weight of 410.62 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-propan-2-ylanilino)butanamide.
| Compound Name | N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-propan-2-ylanilino)butanamide |
|---|---|
| PubChem CID | 133200489 |
| Molecular Formula | C22H38N2O3S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-propan-2-ylanilino)butanamide |
| SMILES | CCCCC(CC)CNC(=O)CCCN(c1ccccc1C(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C22H38N2O3S/c1-6-8-12-19(7-2)17-23-22(25)15-11-16-24(28(5,26)27)21-14-10-9-13-20(21)18(3)4/h9-10,13-14,18-19H,6-8,11-12,15-17H2,1-5H3,(H,23,25) |
| InChIKey | SIRBQVOIKBXRPP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |