C23H32N2O3S — CID 133185431
2-[benzyl(methylsulfonyl)amino]-N-(2-ethylhexyl)benzamide (PubChem CID 133185431) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[benzyl(methylsulfonyl)amino]-N-(2-ethylhexyl)benzamide.
| Compound Name | 2-[benzyl(methylsulfonyl)amino]-N-(2-ethylhexyl)benzamide |
|---|---|
| PubChem CID | 133185431 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[benzyl(methylsulfonyl)amino]-N-(2-ethylhexyl)benzamide |
| SMILES | CCCCC(CC)CNC(=O)c1ccccc1N(Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H32N2O3S/c1-4-6-12-19(5-2)17-24-23(26)21-15-10-11-16-22(21)25(29(3,27)28)18-20-13-8-7-9-14-20/h7-11,13-16,19H,4-6,12,17-18H2,1-3H3,(H,24,26) |
| InChIKey | WMHKDRSPZNPIBV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |