C17H28N2O3S — CID 94612530
N-[(2R)-2-ethylhexyl]-2-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 94612530) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[(2R)-2-ethylhexyl]-2-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[(2R)-2-ethylhexyl]-2-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 94612530 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(2R)-2-ethylhexyl]-2-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | CCCC[C@@H](CC)CNC(=O)c1ccccc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C17H28N2O3S/c1-5-7-10-14(6-2)13-18-17(20)15-11-8-9-12-16(15)19(3)23(4,21)22/h8-9,11-12,14H,5-7,10,13H2,1-4H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | QJXGABLKICDPOO-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |