C17H27BrN2O3S — CID 133185222
2-(2-bromo-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide (PubChem CID 133185222) has the molecular formula C17H27BrN2O3S and a molecular weight of 419.39 g/mol. Its IUPAC name is 2-(2-bromo-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide.
| Compound Name | 2-(2-bromo-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide |
|---|---|
| PubChem CID | 133185222 |
| Molecular Formula | C17H27BrN2O3S |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-(2-bromo-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide |
| SMILES | CCCCC(CC)CNC(=O)CN(c1ccccc1Br)S(C)(=O)=O |
| InChI | InChI=1S/C17H27BrN2O3S/c1-4-6-9-14(5-2)12-19-17(21)13-20(24(3,22)23)16-11-8-7-10-15(16)18/h7-8,10-11,14H,4-6,9,12-13H2,1-3H3,(H,19,21) |
| InChIKey | DDKUBLWORWYLDL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |