C19H32N2O3S — CID 133185254
2-(2,3-dimethyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide (PubChem CID 133185254) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is 2-(2,3-dimethyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide.
| Compound Name | 2-(2,3-dimethyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide |
|---|---|
| PubChem CID | 133185254 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-(2,3-dimethyl-N-methylsulfonylanilino)-N-(2-ethylhexyl)acetamide |
| SMILES | CCCCC(CC)CNC(=O)CN(c1cccc(C)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C19H32N2O3S/c1-6-8-11-17(7-2)13-20-19(22)14-21(25(5,23)24)18-12-9-10-15(3)16(18)4/h9-10,12,17H,6-8,11,13-14H2,1-5H3,(H,20,22) |
| InChIKey | ZLTCTHAPYZJMBT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |