C24H34N2O4S — CID 133185425
N-(2-ethylhexyl)-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 133185425) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is N-(2-ethylhexyl)-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(2-ethylhexyl)-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 133185425 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-(2-ethylhexyl)-2-(2-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | CCCCC(CC)CNC(=O)CN(c1ccccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34N2O4S/c1-5-7-10-20(6-2)17-25-24(27)18-26(22-11-8-9-12-23(22)30-4)31(28,29)21-15-13-19(3)14-16-21/h8-9,11-16,20H,5-7,10,17-18H2,1-4H3,(H,25,27) |
| InChIKey | LZDLWENLUOXKBH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |