C24H33ClN2O3S — CID 133229095
2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylhexyl)acetamide (PubChem CID 133229095) has the molecular formula C24H33ClN2O3S and a molecular weight of 465.06 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylhexyl)acetamide.
| Compound Name | 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylhexyl)acetamide |
|---|---|
| PubChem CID | 133229095 |
| Molecular Formula | C24H33ClN2O3S |
| Molecular Weight | 465.06 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylhexyl)acetamide |
| SMILES | CCCCC(CC)CNC(=O)CN(c1ccc(C)c(Cl)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H33ClN2O3S/c1-5-7-8-20(6-2)16-26-24(28)17-27(21-12-11-19(4)23(25)15-21)31(29,30)22-13-9-18(3)10-14-22/h9-15,20H,5-8,16-17H2,1-4H3,(H,26,28) |
| InChIKey | CQQHXLBWIRVACZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.06 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |