C23H31ClN2O3S — CID 133244646
2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-(2-ethylhexyl)acetamide (PubChem CID 133244646) has the molecular formula C23H31ClN2O3S and a molecular weight of 451.03 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-(2-ethylhexyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-(2-ethylhexyl)acetamide |
|---|---|
| PubChem CID | 133244646 |
| Molecular Formula | C23H31ClN2O3S |
| Molecular Weight | 451.03 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-(2-ethylhexyl)acetamide |
| SMILES | CCCCC(CC)CNC(=O)CN(c1ccc(Cl)cc1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31ClN2O3S/c1-4-6-10-19(5-2)16-25-23(27)17-26(22-14-13-20(24)15-18(22)3)30(28,29)21-11-8-7-9-12-21/h7-9,11-15,19H,4-6,10,16-17H2,1-3H3,(H,25,27) |
| InChIKey | CWSXZWPFPYEHOK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.03 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |