C25H36N2O3S2 — CID 133202011
N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-phenylsulfanylanilino)butanamide (PubChem CID 133202011) has the molecular formula C25H36N2O3S2 and a molecular weight of 476.71 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-phenylsulfanylanilino)butanamide.
| Compound Name | N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-phenylsulfanylanilino)butanamide |
|---|---|
| PubChem CID | 133202011 |
| Molecular Formula | C25H36N2O3S2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-(2-ethylhexyl)-4-(N-methylsulfonyl-2-phenylsulfanylanilino)butanamide |
| SMILES | CCCCC(CC)CNC(=O)CCCN(c1ccccc1Sc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H36N2O3S2/c1-4-6-13-21(5-2)20-26-25(28)18-12-19-27(32(3,29)30)23-16-10-11-17-24(23)31-22-14-8-7-9-15-22/h7-11,14-17,21H,4-6,12-13,18-20H2,1-3H3,(H,26,28) |
| InChIKey | IGDVBECJRVEXCQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |