C22H38N2O4S — CID 133202046
N-(2-ethylhexyl)-4-(N-methylsulfonyl-4-propan-2-yloxyanilino)butanamide (PubChem CID 133202046) has the molecular formula C22H38N2O4S and a molecular weight of 426.62 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-(N-methylsulfonyl-4-propan-2-yloxyanilino)butanamide.
| Compound Name | N-(2-ethylhexyl)-4-(N-methylsulfonyl-4-propan-2-yloxyanilino)butanamide |
|---|---|
| PubChem CID | 133202046 |
| Molecular Formula | C22H38N2O4S |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | N-(2-ethylhexyl)-4-(N-methylsulfonyl-4-propan-2-yloxyanilino)butanamide |
| SMILES | CCCCC(CC)CNC(=O)CCCN(c1ccc(OC(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H38N2O4S/c1-6-8-10-19(7-2)17-23-22(25)11-9-16-24(29(5,26)27)20-12-14-21(15-13-20)28-18(3)4/h12-15,18-19H,6-11,16-17H2,1-5H3,(H,23,25) |
| InChIKey | VWJRWTLUUGHCSN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |