C19H32N2O4S — CID 125064427
(2S)-N-[(2S)-2-ethylhexyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide (PubChem CID 125064427) has the molecular formula C19H32N2O4S and a molecular weight of 384.54 g/mol. Its IUPAC name is (2S)-N-[(2S)-2-ethylhexyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide.
| Compound Name | (2S)-N-[(2S)-2-ethylhexyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide |
|---|---|
| PubChem CID | 125064427 |
| Molecular Formula | C19H32N2O4S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (2S)-N-[(2S)-2-ethylhexyl]-2-[4-[methyl(methylsulfonyl)amino]phenoxy]propanamide |
| SMILES | CCCC[C@H](CC)CNC(=O)[C@H](C)Oc1ccc(N(C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H32N2O4S/c1-6-8-9-16(7-2)14-20-19(22)15(3)25-18-12-10-17(11-13-18)21(4)26(5,23)24/h10-13,15-16H,6-9,14H2,1-5H3,(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | BPRBQTVCJAVKTB-HOTGVXAUSA-N |
| XLogP | 3.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |