C29H35ClN2O4S — CID 133202009
4-[(5-chloro-N-methylsulfonyl-2-phenoxyanilino)methyl]-N-(2-ethylhexyl)benzamide (PubChem CID 133202009) has the molecular formula C29H35ClN2O4S and a molecular weight of 543.13 g/mol. Its IUPAC name is 4-[(5-chloro-N-methylsulfonyl-2-phenoxyanilino)methyl]-N-(2-ethylhexyl)benzamide.
| Compound Name | 4-[(5-chloro-N-methylsulfonyl-2-phenoxyanilino)methyl]-N-(2-ethylhexyl)benzamide |
|---|---|
| PubChem CID | 133202009 |
| Molecular Formula | C29H35ClN2O4S |
| Molecular Weight | 543.13 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 4-[(5-chloro-N-methylsulfonyl-2-phenoxyanilino)methyl]-N-(2-ethylhexyl)benzamide |
| SMILES | CCCCC(CC)CNC(=O)c1ccc(CN(c2cc(Cl)ccc2Oc2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C29H35ClN2O4S/c1-4-6-10-22(5-2)20-31-29(33)24-15-13-23(14-16-24)21-32(37(3,34)35)27-19-25(30)17-18-28(27)36-26-11-8-7-9-12-26/h7-9,11-19,22H,4-6,10,20-21H2,1-3H3,(H,31,33) |
| InChIKey | FRKLCHZGIPDTAL-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.13 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |