C16H24O3 — CID 114715453
2-butyl-2-ethyl-6-methoxy-3,4-dihydrochromen-4-ol (PubChem CID 114715453) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-butyl-2-ethyl-6-methoxy-3,4-dihydrochromen-4-ol.
| Compound Name | 2-butyl-2-ethyl-6-methoxy-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114715453 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-butyl-2-ethyl-6-methoxy-3,4-dihydrochromen-4-ol |
| SMILES | CCCCC1(CC)CC(O)c2cc(OC)ccc2O1 |
| InChI | InChI=1S/C16H24O3/c1-4-6-9-16(5-2)11-14(17)13-10-12(18-3)7-8-15(13)19-16/h7-8,10,14,17H,4-6,9,11H2,1-3H3 |
| InChIKey | NHPIUTCISCWDOU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |