C17H24O2 — CID 107450789
(4S)-3'-propan-2-ylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (PubChem CID 107450789) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (4S)-3'-propan-2-ylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
| Compound Name | (4S)-3'-propan-2-ylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
|---|---|
| PubChem CID | 107450789 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4S)-3'-propan-2-ylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| SMILES | CC(C)C1CCCC2(C1)C[C@H](O)c1ccccc1O2 |
| InChI | InChI=1S/C17H24O2/c1-12(2)13-6-5-9-17(10-13)11-15(18)14-7-3-4-8-16(14)19-17/h3-4,7-8,12-13,15,18H,5-6,9-11H2,1-2H3/t13?,15-,17?/m0/s1 |
| InChIKey | YAHAYXJTPBRJPV-GULBITTBSA-N |
| XLogP | 4.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |