C17H26N2O2 — CID 129058018
3-(5-cyclopropylpentyl)-7-methoxy-1,2,3,4-tetrahydroquinoxalin-2-ol (PubChem CID 129058018) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-(5-cyclopropylpentyl)-7-methoxy-1,2,3,4-tetrahydroquinoxalin-2-ol.
| Compound Name | 3-(5-cyclopropylpentyl)-7-methoxy-1,2,3,4-tetrahydroquinoxalin-2-ol |
|---|---|
| PubChem CID | 129058018 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-(5-cyclopropylpentyl)-7-methoxy-1,2,3,4-tetrahydroquinoxalin-2-ol |
| SMILES | COc1ccc2c(c1)NC(O)C(CCCCCC1CC1)N2 |
| InChI | InChI=1S/C17H26N2O2/c1-21-13-9-10-14-16(11-13)19-17(20)15(18-14)6-4-2-3-5-12-7-8-12/h9-12,15,17-20H,2-8H2,1H3 |
| InChIKey | IIJORTOTJNCKDX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|