C11H13NO5S — CID 84641583
7-methoxy-3-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-2-carboxylic acid (PubChem CID 84641583) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 7-methoxy-3-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-2-carboxylic acid.
| Compound Name | 7-methoxy-3-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-2-carboxylic acid |
|---|---|
| PubChem CID | 84641583 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 7-methoxy-3-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazine-2-carboxylic acid |
| SMILES | COc1ccc2c(c1)S(=O)(=O)C(C(=O)O)C(C)N2 |
| InChI | InChI=1S/C11H13NO5S/c1-6-10(11(13)14)18(15,16)9-5-7(17-2)3-4-8(9)12-6/h3-6,10,12H,1-2H3,(H,13,14) |
| InChIKey | RGRBNLBNZWKEQY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|