C23H26F2N2O3 — CID 58431803
tert-butyl N-[(3S)-1-benzyl-2-(2,5-difluorophenyl)-6-oxopiperidin-3-yl]carbamate (PubChem CID 58431803) has the molecular formula C23H26F2N2O3 and a molecular weight of 416.47 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-benzyl-2-(2,5-difluorophenyl)-6-oxopiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-benzyl-2-(2,5-difluorophenyl)-6-oxopiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58431803 |
| Molecular Formula | C23H26F2N2O3 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl N-[(3S)-1-benzyl-2-(2,5-difluorophenyl)-6-oxopiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC(=O)N(Cc2ccccc2)C1c1cc(F)ccc1F |
| InChI | InChI=1S/C23H26F2N2O3/c1-23(2,3)30-22(29)26-19-11-12-20(28)27(14-15-7-5-4-6-8-15)21(19)17-13-16(24)9-10-18(17)25/h4-10,13,19,21H,11-12,14H2,1-3H3,(H,26,29)/t19-,21?/m0/s1 |
| InChIKey | IEXNTCUXHDJZJZ-ZQRQZVKFSA-N |
| XLogP | 4.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |