C23H28F2N2O2 — CID 66691667
tert-butyl N-[1-benzyl-4-[2-fluoro-5-(fluoromethyl)phenyl]pyrrolidin-3-yl]carbamate (PubChem CID 66691667) has the molecular formula C23H28F2N2O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is tert-butyl N-[1-benzyl-4-[2-fluoro-5-(fluoromethyl)phenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-benzyl-4-[2-fluoro-5-(fluoromethyl)phenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66691667 |
| Molecular Formula | C23H28F2N2O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | tert-butyl N-[1-benzyl-4-[2-fluoro-5-(fluoromethyl)phenyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(Cc2ccccc2)CC1c1cc(CF)ccc1F |
| InChI | InChI=1S/C23H28F2N2O2/c1-23(2,3)29-22(28)26-21-15-27(13-16-7-5-4-6-8-16)14-19(21)18-11-17(12-24)9-10-20(18)25/h4-11,19,21H,12-15H2,1-3H3,(H,26,28) |
| InChIKey | CUJHJPRBQYRNCG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |