C22H27FN2O2 — CID 125181078
tert-butyl N-[(3S,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamate (PubChem CID 125181078) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 125181078 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | tert-butyl N-[(3S,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CN(Cc2ccccc2)C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C22H27FN2O2/c1-22(2,3)27-21(26)24-20-15-25(13-16-8-5-4-6-9-16)14-19(20)17-10-7-11-18(23)12-17/h4-12,19-20H,13-15H2,1-3H3,(H,24,26)/t19-,20-/m1/s1 |
| InChIKey | VHQSLLZPQOHFAQ-WOJBJXKFSA-N |
| XLogP | 4.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |