C23H23ClN4O — CID 31015986
3-[(1R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol (PubChem CID 31015986) has the molecular formula C23H23ClN4O and a molecular weight of 406.92 g/mol. Its IUPAC name is 3-[(1R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol.
| Compound Name | 3-[(1R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol |
|---|---|
| PubChem CID | 31015986 |
| Molecular Formula | C23H23ClN4O |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-[(1R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCc2c([nH]c3ccccc23)[C@H]1c1cccc(O)c1 |
| InChI | InChI=1S/C23H23ClN4O/c1-14-19(23(24)27(2)26-14)13-28-11-10-18-17-8-3-4-9-20(17)25-21(18)22(28)15-6-5-7-16(29)12-15/h3-9,12,22,25,29H,10-11,13H2,1-2H3/t22-/m1/s1 |
| InChIKey | OKZIWXPBJYCNCC-JOCHJYFZSA-N |
| XLogP | 4.72 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|