C22H23N3O2S — CID 3868636
N-(1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioyl)-4-methoxybenzamide (PubChem CID 3868636) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioyl)-4-methoxybenzamide.
| Compound Name | N-(1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 3868636 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioyl)-4-methoxybenzamide |
| SMILES | CCC1c2[nH]c3ccccc3c2CCN1C(=S)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23N3O2S/c1-3-19-20-17(16-6-4-5-7-18(16)23-20)12-13-25(19)22(28)24-21(26)14-8-10-15(27-2)11-9-14/h4-11,19,23H,3,12-13H2,1-2H3,(H,24,26,28) |
| InChIKey | DBPBVXARFXAKSY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|