C37H36Cl2N4O6 — CID 67755516
(3,4-dichlorophenyl) (3R)-3-[(2S)-2-(3-phenylmethoxycarbonylpiperidine-1-carbonyl)pyrrolidine-1-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 67755516) has the molecular formula C37H36Cl2N4O6 and a molecular weight of 703.62 g/mol. Its IUPAC name is (3,4-dichlorophenyl) (3R)-3-[(2S)-2-(3-phenylmethoxycarbonylpiperidine-1-carbonyl)pyrrolidine-1-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (3,4-dichlorophenyl) (3R)-3-[(2S)-2-(3-phenylmethoxycarbonylpiperidine-1-carbonyl)pyrrolidine-1-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67755516 |
| Molecular Formula | C37H36Cl2N4O6 |
| Molecular Weight | 703.62 g/mol |
| Exact Mass | 702.20 |
| IUPAC Name | (3,4-dichlorophenyl) (3R)-3-[(2S)-2-(3-phenylmethoxycarbonylpiperidine-1-carbonyl)pyrrolidine-1-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CCCN(C(=O)[C@@H]2CCCN2C(=O)[C@H]2Cc3c([nH]c4ccccc34)CN2C(=O)Oc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C37H36Cl2N4O6/c38-28-15-14-25(18-29(28)39)49-37(47)43-21-31-27(26-11-4-5-12-30(26)40-31)19-33(43)35(45)42-17-7-13-32(42)34(44)41-16-6-10-24(20-41)36(46)48-22-23-8-2-1-3-9-23/h1-5,8-9,11-12,14-15,18,24,32-33,40H,6-7,10,13,16-17,19-22H2/t24?,32-,33+/m0/s1 |
| InChIKey | SZEVOVMLNFWKPR-REJVIYBWSA-N |
| XLogP | 6.37 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|