C19H19N5O2 — CID 124606314
(2R)-2-N-(1H-indazol-5-yl)-1-N-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 124606314) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is (2R)-2-N-(1H-indazol-5-yl)-1-N-phenylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-(1H-indazol-5-yl)-1-N-phenylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 124606314 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (2R)-2-N-(1H-indazol-5-yl)-1-N-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)[C@H]1CCCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H19N5O2/c25-18(21-15-8-9-16-13(11-15)12-20-23-16)17-7-4-10-24(17)19(26)22-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12,17H,4,7,10H2,(H,20,23)(H,21,25)(H,22,26)/t17-/m1/s1 |
| InChIKey | YPEYZLNUPZETPX-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |