C31H31N3O3 — CID 44760985
N-(3-phenoxyphenyl)-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)cyclohexane-1-carboxamide (PubChem CID 44760985) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-(3-phenoxyphenyl)-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-phenoxyphenyl)-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 44760985 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-(3-phenoxyphenyl)-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)c1)C1CCCCC1C(=O)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C31H31N3O3/c35-30(32-21-9-8-12-23(19-21)37-22-10-2-1-3-11-22)26-14-4-5-15-27(26)31(36)34-18-17-25-24-13-6-7-16-28(24)33-29(25)20-34/h1-3,6-13,16,19,26-27,33H,4-5,14-15,17-18,20H2,(H,32,35) |
| InChIKey | IXIUBJYCPHSLTM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|