C16H21N3 — CID 14105650
N-tert-butyl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanimine (PubChem CID 14105650) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is N-tert-butyl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanimine.
| Compound Name | N-tert-butyl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanimine |
|---|---|
| PubChem CID | 14105650 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-tert-butyl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanimine |
| SMILES | CC(C)(C)/N=C/N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C16H21N3/c1-16(2,3)17-11-19-9-8-13-12-6-4-5-7-14(12)18-15(13)10-19/h4-7,11,18H,8-10H2,1-3H3/b17-11+ |
| InChIKey | ZRJDWWRQSMINQB-GZTJUZNOSA-N |
| XLogP | 3.35 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|