C18H17ClN2OS — CID 113096971
N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-thiophen-2-ylacetamide (PubChem CID 113096971) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113096971 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NC1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C18H17ClN2OS/c19-11-3-5-16-14(8-11)15-9-12(4-6-17(15)21-16)20-18(22)10-13-2-1-7-23-13/h1-3,5,7-8,12,21H,4,6,9-10H2,(H,20,22) |
| InChIKey | MYROZTWHRVGAAP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|