C21H21ClN2O — CID 113097267
N-(7-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methylphenyl)acetamide (PubChem CID 113097267) has the molecular formula C21H21ClN2O and a molecular weight of 352.87 g/mol. Its IUPAC name is N-(7-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methylphenyl)acetamide.
| Compound Name | N-(7-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113097267 |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-(7-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)NC2CCc3[nH]c4cc(Cl)ccc4c3C2)cc1 |
| InChI | InChI=1S/C21H21ClN2O/c1-13-2-4-14(5-3-13)10-21(25)23-16-7-9-19-18(12-16)17-8-6-15(22)11-20(17)24-19/h2-6,8,11,16,24H,7,9-10,12H2,1H3,(H,23,25) |
| InChIKey | ZGVCUGFBDNWLDF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|