C21H20ClFN2O — CID 46098168
N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-fluorophenyl)acetamide (PubChem CID 46098168) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-fluorophenyl)acetamide.
| Compound Name | N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 46098168 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-fluorophenyl)acetamide |
| SMILES | Cc1cc(Cl)cc2c3c([nH]c12)CCC(NC(=O)Cc1ccccc1F)C3 |
| InChI | InChI=1S/C21H20ClFN2O/c1-12-8-14(22)10-17-16-11-15(6-7-19(16)25-21(12)17)24-20(26)9-13-4-2-3-5-18(13)23/h2-5,8,10,15,25H,6-7,9,11H2,1H3,(H,24,26) |
| InChIKey | AHRIJMIQUGGQDL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|