C18H22N2O — CID 92756889
3-methyl-N-[(3R)-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]but-2-enamide (PubChem CID 92756889) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-methyl-N-[(3R)-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]but-2-enamide.
| Compound Name | 3-methyl-N-[(3R)-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 92756889 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-methyl-N-[(3R)-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]but-2-enamide |
| SMILES | CC(C)=CC(=O)N[C@@H]1CCc2[nH]c3c(C)cccc3c2C1 |
| InChI | InChI=1S/C18H22N2O/c1-11(2)9-17(21)19-13-7-8-16-15(10-13)14-6-4-5-12(3)18(14)20-16/h4-6,9,13,20H,7-8,10H2,1-3H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | YTJPCBQAYQAQQN-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|