C22H23ClN2O — CID 46098102
N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-methylphenyl)acetamide (PubChem CID 46098102) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-methylphenyl)acetamide.
| Compound Name | N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 46098102 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(6-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1CC(=O)NC1CCc2[nH]c3c(C)cc(Cl)cc3c2C1 |
| InChI | InChI=1S/C22H23ClN2O/c1-13-5-3-4-6-15(13)10-21(26)24-17-7-8-20-18(12-17)19-11-16(23)9-14(2)22(19)25-20/h3-6,9,11,17,25H,7-8,10,12H2,1-2H3,(H,24,26) |
| InChIKey | AMCLTJSVNLWDKY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|