C21H21FN2O2 — CID 113097150
N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methoxyphenyl)acetamide (PubChem CID 113097150) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113097150 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC2CCc3[nH]c4cc(F)ccc4c3C2)cc1 |
| InChI | InChI=1S/C21H21FN2O2/c1-26-16-6-2-13(3-7-16)10-21(25)23-15-5-9-19-18(12-15)17-8-4-14(22)11-20(17)24-19/h2-4,6-8,11,15,24H,5,9-10,12H2,1H3,(H,23,25) |
| InChIKey | ILHZXXWZDMYXDR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|