C17H15FN2O2 — CID 113097125
N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)furan-2-carboxamide (PubChem CID 113097125) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)furan-2-carboxamide.
| Compound Name | N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 113097125 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(7-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)furan-2-carboxamide |
| SMILES | O=C(NC1CCc2[nH]c3cc(F)ccc3c2C1)c1ccco1 |
| InChI | InChI=1S/C17H15FN2O2/c18-10-3-5-12-13-9-11(4-6-14(13)20-15(12)8-10)19-17(21)16-2-1-7-22-16/h1-3,5,7-8,11,20H,4,6,9H2,(H,19,21) |
| InChIKey | IYYFCJIMOIRYCC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|