C13H15FN2 — CID 84622882
7-fluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine (PubChem CID 84622882) has the molecular formula C13H15FN2 and a molecular weight of 218.28 g/mol. Its IUPAC name is 7-fluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine.
| Compound Name | 7-fluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine |
|---|---|
| PubChem CID | 84622882 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 7-fluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-2-amine |
| SMILES | CNC1CCc2c([nH]c3cc(F)ccc23)C1 |
| InChI | InChI=1S/C13H15FN2/c1-15-9-3-5-11-10-4-2-8(14)6-12(10)16-13(11)7-9/h2,4,6,9,15-16H,3,5,7H2,1H3 |
| InChIKey | HOXLIIYNQFUHBU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|