C17H20N2O3S — CID 110680789
N-(3,4-dimethoxyphenyl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide (PubChem CID 110680789) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 110680789 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCc3nc(C)sc3C2)cc1OC |
| InChI | InChI=1S/C17H20N2O3S/c1-10-18-13-6-4-11(8-16(13)23-10)17(20)19-12-5-7-14(21-2)15(9-12)22-3/h5,7,9,11H,4,6,8H2,1-3H3,(H,19,20) |
| InChIKey | CTNDWJMIWGAKAF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |