C20H24N2O4S — CID 95109010
(5R)-5-N-(3,4-dimethoxyphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide (PubChem CID 95109010) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is (5R)-5-N-(3,4-dimethoxyphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide.
| Compound Name | (5R)-5-N-(3,4-dimethoxyphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 95109010 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (5R)-5-N-(3,4-dimethoxyphenyl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2CCc3sc(C(=O)N(C)C)cc3C2)cc1OC |
| InChI | InChI=1S/C20H24N2O4S/c1-22(2)20(24)18-10-13-9-12(5-8-17(13)27-18)19(23)21-14-6-7-15(25-3)16(11-14)26-4/h6-7,10-12H,5,8-9H2,1-4H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | ZLGAYDBTFNRPMF-GFCCVEGCSA-N |
| XLogP | 3.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |